C36H42N2O5 — CID 101080415
(2,6-ditert-butyl-4-methylphenyl) 3-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)propanoate (PubChem CID 101080415) has the molecular formula C36H42N2O5 and a molecular weight of 582.74 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-methylphenyl) 3-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)propanoate.
| Compound Name | (2,6-ditert-butyl-4-methylphenyl) 3-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)propanoate |
|---|---|
| PubChem CID | 101080415 |
| Molecular Formula | C36H42N2O5 |
| Molecular Weight | 582.74 g/mol |
| Exact Mass | 582.31 |
| IUPAC Name | (2,6-ditert-butyl-4-methylphenyl) 3-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)propanoate |
| SMILES | Cc1cc(C(C)(C)C)c(OC(=O)CCN2c3ccccc3C(C)(C)C23C=Cc2cc([N+](=O)[O-])ccc2O3)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C36H42N2O5/c1-23-20-27(33(2,3)4)32(28(21-23)34(5,6)7)42-31(39)17-19-37-29-13-11-10-12-26(29)35(8,9)36(37)18-16-24-22-25(38(40)41)14-15-30(24)43-36/h10-16,18,20-22H,17,19H2,1-9H3 |
| InChIKey | PYRGIFGWEIVQFP-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.74 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|