C33H42N4O7 — CID 139213608
methyl 5-[3-[3-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)propanoylamino]propylamino]-2,4,4-trimethyl-5-oxopentanoate (PubChem CID 139213608) has the molecular formula C33H42N4O7 and a molecular weight of 606.72 g/mol. Its IUPAC name is methyl 5-[3-[3-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)propanoylamino]propylamino]-2,4,4-trimethyl-5-oxopentanoate.
| Compound Name | methyl 5-[3-[3-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)propanoylamino]propylamino]-2,4,4-trimethyl-5-oxopentanoate |
|---|---|
| PubChem CID | 139213608 |
| Molecular Formula | C33H42N4O7 |
| Molecular Weight | 606.72 g/mol |
| Exact Mass | 606.31 |
| IUPAC Name | methyl 5-[3-[3-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)propanoylamino]propylamino]-2,4,4-trimethyl-5-oxopentanoate |
| SMILES | COC(=O)C(C)CC(C)(C)C(=O)NCCCNC(=O)CCN1c2ccccc2C(C)(C)C12C=Cc1cc([N+](=O)[O-])ccc1O2 |
| InChI | InChI=1S/C33H42N4O7/c1-22(29(39)43-6)21-31(2,3)30(40)35-18-9-17-34-28(38)15-19-36-26-11-8-7-10-25(26)32(4,5)33(36)16-14-23-20-24(37(41)42)12-13-27(23)44-33/h7-8,10-14,16,20,22H,9,15,17-19,21H2,1-6H3,(H,34,38)(H,35,40) |
| InChIKey | XZPWDBUTAWIXOU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.72 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|