C31H26N2O7 — CID 15445129
(4-methyl-2-oxochromen-7-yl) 3-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)propanoate (PubChem CID 15445129) has the molecular formula C31H26N2O7 and a molecular weight of 538.56 g/mol. Its IUPAC name is (4-methyl-2-oxochromen-7-yl) 3-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)propanoate.
| Compound Name | (4-methyl-2-oxochromen-7-yl) 3-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)propanoate |
|---|---|
| PubChem CID | 15445129 |
| Molecular Formula | C31H26N2O7 |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.17 |
| IUPAC Name | (4-methyl-2-oxochromen-7-yl) 3-(3',3'-dimethyl-6-nitrospiro[chromene-2,2'-indole]-1'-yl)propanoate |
| SMILES | Cc1cc(=O)oc2cc(OC(=O)CCN3c4ccccc4C(C)(C)C34C=Cc3cc([N+](=O)[O-])ccc3O4)ccc12 |
| InChI | InChI=1S/C31H26N2O7/c1-19-16-29(35)39-27-18-22(9-10-23(19)27)38-28(34)13-15-32-25-7-5-4-6-24(25)30(2,3)31(32)14-12-20-17-21(33(36)37)8-11-26(20)40-31/h4-12,14,16-18H,13,15H2,1-3H3 |
| InChIKey | URRALPSAZUTZAE-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 112.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|