C21H20F3NO2 — CID 132580346
5'-methoxy-1',3',3'-trimethyl-6-(trifluoromethyl)spiro[chromene-2,2'-indole] (PubChem CID 132580346) has the molecular formula C21H20F3NO2 and a molecular weight of 375.39 g/mol. Its IUPAC name is 5'-methoxy-1',3',3'-trimethyl-6-(trifluoromethyl)spiro[chromene-2,2'-indole].
| Compound Name | 5'-methoxy-1',3',3'-trimethyl-6-(trifluoromethyl)spiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 132580346 |
| Molecular Formula | C21H20F3NO2 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 5'-methoxy-1',3',3'-trimethyl-6-(trifluoromethyl)spiro[chromene-2,2'-indole] |
| SMILES | COc1ccc2c(c1)C(C)(C)C1(C=Cc3cc(C(F)(F)F)ccc3O1)N2C |
| InChI | InChI=1S/C21H20F3NO2/c1-19(2)16-12-15(26-4)6-7-17(16)25(3)20(19)10-9-13-11-14(21(22,23)24)5-8-18(13)27-20/h5-12H,1-4H3 |
| InChIKey | HQXIPOKHLCJCBC-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|