C23H23NO2 — CID 177475501
(Z)-4-(1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-yl)but-3-en-2-one (PubChem CID 177475501) has the molecular formula C23H23NO2 and a molecular weight of 345.44 g/mol. Its IUPAC name is (Z)-4-(1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-yl)but-3-en-2-one.
| Compound Name | (Z)-4-(1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 177475501 |
| Molecular Formula | C23H23NO2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | (Z)-4-(1',3',3'-trimethylspiro[chromene-2,2'-indole]-6-yl)but-3-en-2-one |
| SMILES | CC(=O)/C=C\c1ccc2c(c1)C=CC1(O2)N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C23H23NO2/c1-16(25)9-10-17-11-12-21-18(15-17)13-14-23(26-21)22(2,3)19-7-5-6-8-20(19)24(23)4/h5-15H,1-4H3/b10-9- |
| InChIKey | ACCJZUSKWYNVRT-KTKRTIGZSA-N |
| XLogP | 4.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|