C20H20BrNO2 — CID 1100889
2-[(2S)-6-bromo-3',3'-dimethylspiro[chromene-2,2'-indole]-1'-yl]ethanol (PubChem CID 1100889) has the molecular formula C20H20BrNO2 and a molecular weight of 386.29 g/mol. Its IUPAC name is 2-[(2S)-6-bromo-3',3'-dimethylspiro[chromene-2,2'-indole]-1'-yl]ethanol.
| Compound Name | 2-[(2S)-6-bromo-3',3'-dimethylspiro[chromene-2,2'-indole]-1'-yl]ethanol |
|---|---|
| PubChem CID | 1100889 |
| Molecular Formula | C20H20BrNO2 |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 2-[(2S)-6-bromo-3',3'-dimethylspiro[chromene-2,2'-indole]-1'-yl]ethanol |
| SMILES | CC1(C)c2ccccc2N(CCO)[C@]12C=Cc1cc(Br)ccc1O2 |
| InChI | InChI=1S/C20H20BrNO2/c1-19(2)16-5-3-4-6-17(16)22(11-12-23)20(19)10-9-14-13-15(21)7-8-18(14)24-20/h3-10,13,23H,11-12H2,1-2H3/t20-/m0/s1 |
| InChIKey | SJHYCCGHOJCXHQ-FQEVSTJZSA-N |
| XLogP | 4.34 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |