C20H18BrN3O6 — CID 3104860
2-(8-bromo-3',3'-dimethyl-5',6-dinitrospiro[chromene-2,2'-indole]-1'-yl)ethanol (PubChem CID 3104860) has the molecular formula C20H18BrN3O6 and a molecular weight of 476.28 g/mol. Its IUPAC name is 2-(8-bromo-3',3'-dimethyl-5',6-dinitrospiro[chromene-2,2'-indole]-1'-yl)ethanol.
| Compound Name | 2-(8-bromo-3',3'-dimethyl-5',6-dinitrospiro[chromene-2,2'-indole]-1'-yl)ethanol |
|---|---|
| PubChem CID | 3104860 |
| Molecular Formula | C20H18BrN3O6 |
| Molecular Weight | 476.28 g/mol |
| Exact Mass | 475.04 |
| IUPAC Name | 2-(8-bromo-3',3'-dimethyl-5',6-dinitrospiro[chromene-2,2'-indole]-1'-yl)ethanol |
| SMILES | CC1(C)c2cc([N+](=O)[O-])ccc2N(CCO)C12C=Cc1cc([N+](=O)[O-])cc(Br)c1O2 |
| InChI | InChI=1S/C20H18BrN3O6/c1-19(2)15-10-13(23(26)27)3-4-17(15)22(7-8-25)20(19)6-5-12-9-14(24(28)29)11-16(21)18(12)30-20/h3-6,9-11,25H,7-8H2,1-2H3 |
| InChIKey | PSNCNECFKAAUFM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.28 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|