C20H18N4O8 — CID 19084033
8-methoxy-1',3',3'-trimethyl-5,5',6-trinitrospiro[chromene-2,2'-indole] (PubChem CID 19084033) has the molecular formula C20H18N4O8 and a molecular weight of 442.38 g/mol. Its IUPAC name is 8-methoxy-1',3',3'-trimethyl-5,5',6-trinitrospiro[chromene-2,2'-indole].
| Compound Name | 8-methoxy-1',3',3'-trimethyl-5,5',6-trinitrospiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 19084033 |
| Molecular Formula | C20H18N4O8 |
| Molecular Weight | 442.38 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 8-methoxy-1',3',3'-trimethyl-5,5',6-trinitrospiro[chromene-2,2'-indole] |
| SMILES | COc1cc([N+](=O)[O-])c([N+](=O)[O-])c2c1OC1(C=C2)N(C)c2ccc([N+](=O)[O-])cc2C1(C)C |
| InChI | InChI=1S/C20H18N4O8/c1-19(2)13-9-11(22(25)26)5-6-14(13)21(3)20(19)8-7-12-17(24(29)30)15(23(27)28)10-16(31-4)18(12)32-20/h5-10H,1-4H3 |
| InChIKey | PAZDMKGXIQWPMX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 151.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|