C25H29N3O7 — CID 19083773
5,7-dimethoxy-3',3'-dimethyl-1'-(3-methylbutyl)-5',6-dinitrospiro[chromene-2,2'-indole] (PubChem CID 19083773) has the molecular formula C25H29N3O7 and a molecular weight of 483.52 g/mol. Its IUPAC name is 5,7-dimethoxy-3',3'-dimethyl-1'-(3-methylbutyl)-5',6-dinitrospiro[chromene-2,2'-indole].
| Compound Name | 5,7-dimethoxy-3',3'-dimethyl-1'-(3-methylbutyl)-5',6-dinitrospiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 19083773 |
| Molecular Formula | C25H29N3O7 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | 5,7-dimethoxy-3',3'-dimethyl-1'-(3-methylbutyl)-5',6-dinitrospiro[chromene-2,2'-indole] |
| SMILES | COc1cc2c(c(OC)c1[N+](=O)[O-])C=CC1(O2)N(CCC(C)C)c2ccc([N+](=O)[O-])cc2C1(C)C |
| InChI | InChI=1S/C25H29N3O7/c1-15(2)10-12-26-19-8-7-16(27(29)30)13-18(19)24(3,4)25(26)11-9-17-20(35-25)14-21(33-5)22(28(31)32)23(17)34-6/h7-9,11,13-15H,10,12H2,1-6H3 |
| InChIKey | VXEVIOSVGKFWQZ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 117.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|