C28H22N2O3 — CID 7230761
(3S)-3',3'-dimethyl-8-nitro-1'-phenylspiro[benzo[f]chromene-3,2'-indole] (PubChem CID 7230761) has the molecular formula C28H22N2O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is (3S)-3',3'-dimethyl-8-nitro-1'-phenylspiro[benzo[f]chromene-3,2'-indole].
| Compound Name | (3S)-3',3'-dimethyl-8-nitro-1'-phenylspiro[benzo[f]chromene-3,2'-indole] |
|---|---|
| PubChem CID | 7230761 |
| Molecular Formula | C28H22N2O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | (3S)-3',3'-dimethyl-8-nitro-1'-phenylspiro[benzo[f]chromene-3,2'-indole] |
| SMILES | CC1(C)c2ccccc2N(c2ccccc2)[C@]12C=Cc1c(ccc3cc([N+](=O)[O-])ccc13)O2 |
| InChI | InChI=1S/C28H22N2O3/c1-27(2)24-10-6-7-11-25(24)29(20-8-4-3-5-9-20)28(27)17-16-23-22-14-13-21(30(31)32)18-19(22)12-15-26(23)33-28/h3-18H,1-2H3/t28-/m0/s1 |
| InChIKey | QSFCLZNANKJILV-NDEPHWFRSA-N |
| XLogP | 6.98 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|