C23H21NO2 — CID 19083901
1',3',3'-trimethylspiro[benzo[f]chromene-3,2'-indole]-9-ol (PubChem CID 19083901) has the molecular formula C23H21NO2 and a molecular weight of 343.43 g/mol. Its IUPAC name is 1',3',3'-trimethylspiro[benzo[f]chromene-3,2'-indole]-9-ol.
| Compound Name | 1',3',3'-trimethylspiro[benzo[f]chromene-3,2'-indole]-9-ol |
|---|---|
| PubChem CID | 19083901 |
| Molecular Formula | C23H21NO2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 1',3',3'-trimethylspiro[benzo[f]chromene-3,2'-indole]-9-ol |
| SMILES | CN1c2ccccc2C(C)(C)C12C=Cc1c(ccc3ccc(O)cc13)O2 |
| InChI | InChI=1S/C23H21NO2/c1-22(2)19-6-4-5-7-20(19)24(3)23(22)13-12-17-18-14-16(25)10-8-15(18)9-11-21(17)26-23/h4-14,25H,1-3H3 |
| InChIKey | ZGKZSQCVTXPQLG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |