C19H21N2O+ — CID 102430118
1,3,3,5'-tetramethylspiro[indole-2,2'-pyrano[3,2-b]pyridin-5-ium] (PubChem CID 102430118) has the molecular formula C19H21N2O+ and a molecular weight of 293.39 g/mol. Its IUPAC name is 1,3,3,5'-tetramethylspiro[indole-2,2'-pyrano[3,2-b]pyridin-5-ium].
| Compound Name | 1,3,3,5'-tetramethylspiro[indole-2,2'-pyrano[3,2-b]pyridin-5-ium] |
|---|---|
| PubChem CID | 102430118 |
| Molecular Formula | C19H21N2O+ |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 1,3,3,5'-tetramethylspiro[indole-2,2'-pyrano[3,2-b]pyridin-5-ium] |
| SMILES | CN1c2ccccc2C(C)(C)C12C=Cc1c(ccc[n+]1C)O2 |
| InChI | InChI=1S/C19H21N2O/c1-18(2)14-8-5-6-9-15(14)21(4)19(18)12-11-16-17(22-19)10-7-13-20(16)3/h5-13H,1-4H3/q+1 |
| InChIKey | RKLHPCOAGUXISE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|