C22H22N3O+ — CID 139200847
(2R)-1,3,3,7'-tetramethylspiro[indole-2,3'-pyrido[3,2-f][1,4]benzoxazin-7-ium] (PubChem CID 139200847) has the molecular formula C22H22N3O+ and a molecular weight of 344.44 g/mol. Its IUPAC name is (2R)-1,3,3,7'-tetramethylspiro[indole-2,3'-pyrido[3,2-f][1,4]benzoxazin-7-ium].
| Compound Name | (2R)-1,3,3,7'-tetramethylspiro[indole-2,3'-pyrido[3,2-f][1,4]benzoxazin-7-ium] |
|---|---|
| PubChem CID | 139200847 |
| Molecular Formula | C22H22N3O+ |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (2R)-1,3,3,7'-tetramethylspiro[indole-2,3'-pyrido[3,2-f][1,4]benzoxazin-7-ium] |
| SMILES | CN1c2ccccc2C(C)(C)[C@@]12C=Nc1c(ccc3c1ccc[n+]3C)O2 |
| InChI | InChI=1S/C22H22N3O/c1-21(2)16-9-5-6-10-18(16)25(4)22(21)14-23-20-15-8-7-13-24(3)17(15)11-12-19(20)26-22/h5-14H,1-4H3/q+1/t22-/m0/s1 |
| InChIKey | GYRNFOYAJPKFRG-QFIPXVFZSA-N |
| XLogP | 3.88 |
| TPSA | 28.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|