C21H24N2O — CID 1399149
(2R)-1',3',3',5,7,8-hexamethylspiro[1,4-benzoxazine-2,2'-indole] (PubChem CID 1399149) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is (2R)-1',3',3',5,7,8-hexamethylspiro[1,4-benzoxazine-2,2'-indole].
| Compound Name | (2R)-1',3',3',5,7,8-hexamethylspiro[1,4-benzoxazine-2,2'-indole] |
|---|---|
| PubChem CID | 1399149 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | (2R)-1',3',3',5,7,8-hexamethylspiro[1,4-benzoxazine-2,2'-indole] |
| SMILES | Cc1cc(C)c2c(c1C)O[C@]1(C=N2)N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C21H24N2O/c1-13-11-14(2)18-19(15(13)3)24-21(12-22-18)20(4,5)16-9-7-8-10-17(16)23(21)6/h7-12H,1-6H3/t21-/m0/s1 |
| InChIKey | RVQVQQRVJJKSOF-NRFANRHFSA-N |
| XLogP | 4.83 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |