C26H27N3O — CID 166883447
5'-[(Z)-but-1-enyl]-1,3,3,6'-tetramethylspiro[indole-2,2'-pyrido[2,3-h][1,4]benzoxazine] (PubChem CID 166883447) has the molecular formula C26H27N3O and a molecular weight of 397.52 g/mol. Its IUPAC name is 5'-[(Z)-but-1-enyl]-1,3,3,6'-tetramethylspiro[indole-2,2'-pyrido[2,3-h][1,4]benzoxazine].
| Compound Name | 5'-[(Z)-but-1-enyl]-1,3,3,6'-tetramethylspiro[indole-2,2'-pyrido[2,3-h][1,4]benzoxazine] |
|---|---|
| PubChem CID | 166883447 |
| Molecular Formula | C26H27N3O |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 5'-[(Z)-but-1-enyl]-1,3,3,6'-tetramethylspiro[indole-2,2'-pyrido[2,3-h][1,4]benzoxazine] |
| SMILES | CC/C=C\c1c2c(c3cccnc3c1C)OC1(C=N2)N(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C26H27N3O/c1-6-7-11-18-17(2)22-19(12-10-15-27-22)24-23(18)28-16-26(30-24)25(3,4)20-13-8-9-14-21(20)29(26)5/h7-16H,6H2,1-5H3/b11-7- |
| InChIKey | AEQVRZHQOVZCAB-XFFZJAGNSA-N |
| XLogP | 6.19 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |