C27H37N2O+ — CID 177412428
3,3,5',6'-tetramethyl-1-octylspiro[indole-2,2'-pyrano[3,2-b]pyridin-5-ium] (PubChem CID 177412428) has the molecular formula C27H37N2O+ and a molecular weight of 405.61 g/mol. Its IUPAC name is 3,3,5',6'-tetramethyl-1-octylspiro[indole-2,2'-pyrano[3,2-b]pyridin-5-ium].
| Compound Name | 3,3,5',6'-tetramethyl-1-octylspiro[indole-2,2'-pyrano[3,2-b]pyridin-5-ium] |
|---|---|
| PubChem CID | 177412428 |
| Molecular Formula | C27H37N2O+ |
| Molecular Weight | 405.61 g/mol |
| Exact Mass | 405.29 |
| IUPAC Name | 3,3,5',6'-tetramethyl-1-octylspiro[indole-2,2'-pyrano[3,2-b]pyridin-5-ium] |
| SMILES | CCCCCCCCN1c2ccccc2C(C)(C)C12C=Cc1c(ccc(C)[n+]1C)O2 |
| InChI | InChI=1S/C27H37N2O/c1-6-7-8-9-10-13-20-29-23-15-12-11-14-22(23)26(3,4)27(29)19-18-24-25(30-27)17-16-21(2)28(24)5/h11-12,14-19H,6-10,13,20H2,1-5H3/q+1 |
| InChIKey | XNABNZYQTOJXLA-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.61 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|