C34H23NO5 — CID 19084502
3'-(4-methoxyphenyl)-8-nitro-2'-phenylspiro[benzo[f]chromene-3,4'-chromene] (PubChem CID 19084502) has the molecular formula C34H23NO5 and a molecular weight of 525.56 g/mol. Its IUPAC name is 3'-(4-methoxyphenyl)-8-nitro-2'-phenylspiro[benzo[f]chromene-3,4'-chromene].
| Compound Name | 3'-(4-methoxyphenyl)-8-nitro-2'-phenylspiro[benzo[f]chromene-3,4'-chromene] |
|---|---|
| PubChem CID | 19084502 |
| Molecular Formula | C34H23NO5 |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | 3'-(4-methoxyphenyl)-8-nitro-2'-phenylspiro[benzo[f]chromene-3,4'-chromene] |
| SMILES | COc1ccc(C2=C(c3ccccc3)Oc3ccccc3C23C=Cc2c(ccc4cc([N+](=O)[O-])ccc24)O3)cc1 |
| InChI | InChI=1S/C34H23NO5/c1-38-26-15-11-22(12-16-26)32-33(23-7-3-2-4-8-23)39-31-10-6-5-9-29(31)34(32)20-19-28-27-17-14-25(35(36)37)21-24(27)13-18-30(28)40-34/h2-21H,1H3 |
| InChIKey | OEQPSYGFJBWJKP-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|