C28H25NO2 — CID 23363453
4-(8-methoxy-3-phenylbenzo[f]chromen-3-yl)-N,N-dimethylaniline (PubChem CID 23363453) has the molecular formula C28H25NO2 and a molecular weight of 407.51 g/mol. Its IUPAC name is 4-(8-methoxy-3-phenylbenzo[f]chromen-3-yl)-N,N-dimethylaniline.
| Compound Name | 4-(8-methoxy-3-phenylbenzo[f]chromen-3-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 23363453 |
| Molecular Formula | C28H25NO2 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 4-(8-methoxy-3-phenylbenzo[f]chromen-3-yl)-N,N-dimethylaniline |
| SMILES | COc1ccc2c3c(ccc2c1)OC(c1ccccc1)(c1ccc(N(C)C)cc1)C=C3 |
| InChI | InChI=1S/C28H25NO2/c1-29(2)23-12-10-22(11-13-23)28(21-7-5-4-6-8-21)18-17-26-25-15-14-24(30-3)19-20(25)9-16-27(26)31-28/h4-19H,1-3H3 |
| InChIKey | RRPMWGMVAFFORP-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|