C45H44N2O5 — CID 102259865
[2,2-bis[4-(dimethylamino)phenyl]-9-methoxybenzo[h]chromen-5-yl]-bis(4-methoxyphenyl)methanol (PubChem CID 102259865) has the molecular formula C45H44N2O5 and a molecular weight of 692.86 g/mol. Its IUPAC name is [2,2-bis[4-(dimethylamino)phenyl]-9-methoxybenzo[h]chromen-5-yl]-bis(4-methoxyphenyl)methanol.
| Compound Name | [2,2-bis[4-(dimethylamino)phenyl]-9-methoxybenzo[h]chromen-5-yl]-bis(4-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 102259865 |
| Molecular Formula | C45H44N2O5 |
| Molecular Weight | 692.86 g/mol |
| Exact Mass | 692.33 |
| IUPAC Name | [2,2-bis[4-(dimethylamino)phenyl]-9-methoxybenzo[h]chromen-5-yl]-bis(4-methoxyphenyl)methanol |
| SMILES | COc1ccc(C(O)(c2ccc(OC)cc2)c2cc3ccc(OC)cc3c3c2C=CC(c2ccc(N(C)C)cc2)(c2ccc(N(C)C)cc2)O3)cc1 |
| InChI | InChI=1S/C45H44N2O5/c1-46(2)35-17-9-31(10-18-35)44(32-11-19-36(20-12-32)47(3)4)27-26-40-42(28-30-8-21-39(51-7)29-41(30)43(40)52-44)45(48,33-13-22-37(49-5)23-14-33)34-15-24-38(50-6)25-16-34/h8-29,48H,1-7H3 |
| InChIKey | JCCFFQPVZHROAL-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.86 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|