C44H36O6 — CID 4316919
4,4,17,17-tetrakis(4-methoxyphenyl)-3,18-dioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),5,8,10,12,15-heptaene (PubChem CID 4316919) has the molecular formula C44H36O6 and a molecular weight of 660.77 g/mol. Its IUPAC name is 4,4,17,17-tetrakis(4-methoxyphenyl)-3,18-dioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),5,8,10,12,15-heptaene.
| Compound Name | 4,4,17,17-tetrakis(4-methoxyphenyl)-3,18-dioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),5,8,10,12,15-heptaene |
|---|---|
| PubChem CID | 4316919 |
| Molecular Formula | C44H36O6 |
| Molecular Weight | 660.77 g/mol |
| Exact Mass | 660.25 |
| IUPAC Name | 4,4,17,17-tetrakis(4-methoxyphenyl)-3,18-dioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),5,8,10,12,15-heptaene |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)C=Cc3c(c4c(c5ccccc35)C=CC(c3ccc(OC)cc3)(c3ccc(OC)cc3)O4)O2)cc1 |
| InChI | InChI=1S/C44H36O6/c1-45-33-17-9-29(10-18-33)43(30-11-19-34(46-2)20-12-30)27-25-39-37-7-5-6-8-38(37)40-26-28-44(50-42(40)41(39)49-43,31-13-21-35(47-3)22-14-31)32-15-23-36(48-4)24-16-32/h5-28H,1-4H3 |
| InChIKey | KCZHFRIGOJPIKC-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.77 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |