C29H22O5 — CID 15508915
10,10-bis(4-methoxyphenyl)-4,11-dioxatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),7(12),8,13,15-hexaen-5-one (PubChem CID 15508915) has the molecular formula C29H22O5 and a molecular weight of 450.49 g/mol. Its IUPAC name is 10,10-bis(4-methoxyphenyl)-4,11-dioxatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),7(12),8,13,15-hexaen-5-one.
| Compound Name | 10,10-bis(4-methoxyphenyl)-4,11-dioxatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),7(12),8,13,15-hexaen-5-one |
|---|---|
| PubChem CID | 15508915 |
| Molecular Formula | C29H22O5 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 10,10-bis(4-methoxyphenyl)-4,11-dioxatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),7(12),8,13,15-hexaen-5-one |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)C=Cc3c4c(c5ccccc5c3O2)COC4=O)cc1 |
| InChI | InChI=1S/C29H22O5/c1-31-20-11-7-18(8-12-20)29(19-9-13-21(32-2)14-10-19)16-15-24-26-25(17-33-28(26)30)22-5-3-4-6-23(22)27(24)34-29/h3-16H,17H2,1-2H3 |
| InChIKey | SPEYMFHZGAPQAW-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |