C35H26O6 — CID 15451149
18-methoxy-11,11-bis(4-methoxyphenyl)-12,22-dioxapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8(13),9,15(20),16,18-nonaen-21-one (PubChem CID 15451149) has the molecular formula C35H26O6 and a molecular weight of 542.59 g/mol. Its IUPAC name is 18-methoxy-11,11-bis(4-methoxyphenyl)-12,22-dioxapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8(13),9,15(20),16,18-nonaen-21-one.
| Compound Name | 18-methoxy-11,11-bis(4-methoxyphenyl)-12,22-dioxapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8(13),9,15(20),16,18-nonaen-21-one |
|---|---|
| PubChem CID | 15451149 |
| Molecular Formula | C35H26O6 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | 18-methoxy-11,11-bis(4-methoxyphenyl)-12,22-dioxapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8(13),9,15(20),16,18-nonaen-21-one |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)C=Cc3c(c4c5ccc(OC)cc5c(=O)oc4c4ccccc34)O2)cc1 |
| InChI | InChI=1S/C35H26O6/c1-37-23-12-8-21(9-13-23)35(22-10-14-24(38-2)15-11-22)19-18-29-26-6-4-5-7-28(26)32-31(33(29)41-35)27-17-16-25(39-3)20-30(27)34(36)40-32/h4-20H,1-3H3 |
| InChIKey | RYVGWZFTVIKTKK-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|