C33H22F2O4 — CID 156852926
2,2-bis(4-fluorophenyl)-9-methoxy-6-phenylbenzo[h]chromene-5-carboxylic acid (PubChem CID 156852926) has the molecular formula C33H22F2O4 and a molecular weight of 520.53 g/mol. Its IUPAC name is 2,2-bis(4-fluorophenyl)-9-methoxy-6-phenylbenzo[h]chromene-5-carboxylic acid.
| Compound Name | 2,2-bis(4-fluorophenyl)-9-methoxy-6-phenylbenzo[h]chromene-5-carboxylic acid |
|---|---|
| PubChem CID | 156852926 |
| Molecular Formula | C33H22F2O4 |
| Molecular Weight | 520.53 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | 2,2-bis(4-fluorophenyl)-9-methoxy-6-phenylbenzo[h]chromene-5-carboxylic acid |
| SMILES | COc1ccc2c(-c3ccccc3)c(C(=O)O)c3c(c2c1)OC(c1ccc(F)cc1)(c1ccc(F)cc1)C=C3 |
| InChI | InChI=1S/C33H22F2O4/c1-38-25-15-16-26-28(19-25)31-27(30(32(36)37)29(26)20-5-3-2-4-6-20)17-18-33(39-31,21-7-11-23(34)12-8-21)22-9-13-24(35)14-10-22/h2-19H,1H3,(H,36,37) |
| InChIKey | IAFKXBCNYAXPRF-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.53 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |