C34H32FNO4 — CID 22895158
methyl 2-(2-fluorophenyl)-9-methoxy-6-methyl-2-(4-piperidin-1-ylphenyl)benzo[h]chromene-5-carboxylate (PubChem CID 22895158) has the molecular formula C34H32FNO4 and a molecular weight of 537.63 g/mol. Its IUPAC name is methyl 2-(2-fluorophenyl)-9-methoxy-6-methyl-2-(4-piperidin-1-ylphenyl)benzo[h]chromene-5-carboxylate.
| Compound Name | methyl 2-(2-fluorophenyl)-9-methoxy-6-methyl-2-(4-piperidin-1-ylphenyl)benzo[h]chromene-5-carboxylate |
|---|---|
| PubChem CID | 22895158 |
| Molecular Formula | C34H32FNO4 |
| Molecular Weight | 537.63 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | methyl 2-(2-fluorophenyl)-9-methoxy-6-methyl-2-(4-piperidin-1-ylphenyl)benzo[h]chromene-5-carboxylate |
| SMILES | COC(=O)c1c2c(c3cc(OC)ccc3c1C)OC(c1ccc(N3CCCCC3)cc1)(c1ccccc1F)C=C2 |
| InChI | InChI=1S/C34H32FNO4/c1-22-26-16-15-25(38-2)21-28(26)32-27(31(22)33(37)39-3)17-18-34(40-32,29-9-5-6-10-30(29)35)23-11-13-24(14-12-23)36-19-7-4-8-20-36/h5-6,9-18,21H,4,7-8,19-20H2,1-3H3 |
| InChIKey | WGVMCUVRMPNAGC-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.63 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|