C46H43NO3 — CID 143661435
ethane;methyl 8-[4-(4-methylphenyl)phenyl]-2-phenyl-2-(4-pyrrolidin-1-ylphenyl)benzo[h]chromene-5-carboxylate (PubChem CID 143661435) has the molecular formula C46H43NO3 and a molecular weight of 657.85 g/mol. Its IUPAC name is ethane;methyl 8-[4-(4-methylphenyl)phenyl]-2-phenyl-2-(4-pyrrolidin-1-ylphenyl)benzo[h]chromene-5-carboxylate.
| Compound Name | ethane;methyl 8-[4-(4-methylphenyl)phenyl]-2-phenyl-2-(4-pyrrolidin-1-ylphenyl)benzo[h]chromene-5-carboxylate |
|---|---|
| PubChem CID | 143661435 |
| Molecular Formula | C46H43NO3 |
| Molecular Weight | 657.85 g/mol |
| Exact Mass | 657.32 |
| IUPAC Name | ethane;methyl 8-[4-(4-methylphenyl)phenyl]-2-phenyl-2-(4-pyrrolidin-1-ylphenyl)benzo[h]chromene-5-carboxylate |
| SMILES | CC.COC(=O)c1cc2cc(-c3ccc(-c4ccc(C)cc4)cc3)ccc2c2c1C=CC(c1ccccc1)(c1ccc(N3CCCC3)cc1)O2 |
| InChI | InChI=1S/C44H37NO3.C2H6/c1-30-10-12-31(13-11-30)32-14-16-33(17-15-32)34-18-23-39-35(28-34)29-41(43(46)47-2)40-24-25-44(48-42(39)40,36-8-4-3-5-9-36)37-19-21-38(22-20-37)45-26-6-7-27-45;1-2/h3-5,8-25,28-29H,6-7,26-27H2,1-2H3;1-2H3 |
| InChIKey | SWJBPWKXMGMNFD-UHFFFAOYSA-N |
| XLogP | 11.24 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.85 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|