C50H49NO3 — CID 170973439
4-[4-[5-(4-methoxyphenyl)-11-methyl-18-phenyl-21,21-dipropyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenyl]morpholine (PubChem CID 170973439) has the molecular formula C50H49NO3 and a molecular weight of 711.95 g/mol. Its IUPAC name is 4-[4-[5-(4-methoxyphenyl)-11-methyl-18-phenyl-21,21-dipropyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenyl]morpholine.
| Compound Name | 4-[4-[5-(4-methoxyphenyl)-11-methyl-18-phenyl-21,21-dipropyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenyl]morpholine |
|---|---|
| PubChem CID | 170973439 |
| Molecular Formula | C50H49NO3 |
| Molecular Weight | 711.95 g/mol |
| Exact Mass | 711.37 |
| IUPAC Name | 4-[4-[5-(4-methoxyphenyl)-11-methyl-18-phenyl-21,21-dipropyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenyl]morpholine |
| SMILES | CCCC1(CCC)c2cc(-c3ccccc3)ccc2-c2c1c1c(c3ccc(C)cc23)OC(c2ccc(OC)cc2)(c2ccc(N3CCOCC3)cc2)C=C1 |
| InChI | InChI=1S/C50H49NO3/c1-5-25-49(26-6-2)45-33-36(35-10-8-7-9-11-35)13-23-42(45)46-44-32-34(3)12-22-41(44)48-43(47(46)49)24-27-50(54-48,38-16-20-40(52-4)21-17-38)37-14-18-39(19-15-37)51-28-30-53-31-29-51/h7-24,27,32-33H,5-6,25-26,28-31H2,1-4H3 |
| InChIKey | MZMJAKGEHIINKE-UHFFFAOYSA-N |
| XLogP | 11.88 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.95 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|