C44H44FNO3S — CID 146268198
4-[4-[5-(4-fluorophenyl)-11-methoxy-18-methylsulfanyl-21,21-dipropyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenyl]morpholine (PubChem CID 146268198) has the molecular formula C44H44FNO3S and a molecular weight of 685.90 g/mol. Its IUPAC name is 4-[4-[5-(4-fluorophenyl)-11-methoxy-18-methylsulfanyl-21,21-dipropyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenyl]morpholine.
| Compound Name | 4-[4-[5-(4-fluorophenyl)-11-methoxy-18-methylsulfanyl-21,21-dipropyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenyl]morpholine |
|---|---|
| PubChem CID | 146268198 |
| Molecular Formula | C44H44FNO3S |
| Molecular Weight | 685.90 g/mol |
| Exact Mass | 685.30 |
| IUPAC Name | 4-[4-[5-(4-fluorophenyl)-11-methoxy-18-methylsulfanyl-21,21-dipropyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenyl]morpholine |
| SMILES | CCCC1(CCC)c2cc(SC)ccc2-c2c1c1c(c3ccc(OC)cc23)OC(c2ccc(F)cc2)(c2ccc(N3CCOCC3)cc2)C=C1 |
| InChI | InChI=1S/C44H44FNO3S/c1-5-20-43(21-6-2)39-28-34(50-4)16-18-36(39)40-38-27-33(47-3)15-17-35(38)42-37(41(40)43)19-22-44(49-42,29-7-11-31(45)12-8-29)30-9-13-32(14-10-30)46-23-25-48-26-24-46/h7-19,22,27-28H,5-6,20-21,23-26H2,1-4H3 |
| InChIKey | CYERGKANGBAQTE-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.90 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|