C43H40F3NO4 — CID 169307150
4-[4-[21,21-diethyl-10-methoxy-5-(4-methoxyphenyl)-18-(trifluoromethyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenyl]morpholine (PubChem CID 169307150) has the molecular formula C43H40F3NO4 and a molecular weight of 691.79 g/mol. Its IUPAC name is 4-[4-[21,21-diethyl-10-methoxy-5-(4-methoxyphenyl)-18-(trifluoromethyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenyl]morpholine.
| Compound Name | 4-[4-[21,21-diethyl-10-methoxy-5-(4-methoxyphenyl)-18-(trifluoromethyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenyl]morpholine |
|---|---|
| PubChem CID | 169307150 |
| Molecular Formula | C43H40F3NO4 |
| Molecular Weight | 691.79 g/mol |
| Exact Mass | 691.29 |
| IUPAC Name | 4-[4-[21,21-diethyl-10-methoxy-5-(4-methoxyphenyl)-18-(trifluoromethyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenyl]morpholine |
| SMILES | CCC1(CC)c2cc(C(F)(F)F)ccc2-c2c1c1c(c3cc(OC)ccc23)OC(c2ccc(OC)cc2)(c2ccc(N3CCOCC3)cc2)C=C1 |
| InChI | InChI=1S/C43H40F3NO4/c1-5-41(6-2)37-25-29(43(44,45)46)11-17-34(37)38-33-18-16-32(49-4)26-36(33)40-35(39(38)41)19-20-42(51-40,28-9-14-31(48-3)15-10-28)27-7-12-30(13-8-27)47-21-23-50-24-22-47/h7-20,25-26H,5-6,21-24H2,1-4H3 |
| InChIKey | GJOKGZVQZVAOMO-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.79 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|