C47H51NO7 — CID 170010609
4-[4-[21,21-bis(2-ethoxyethyl)-10,18-dimethoxy-5-(4-methoxyphenyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenyl]morpholine (PubChem CID 170010609) has the molecular formula C47H51NO7 and a molecular weight of 741.92 g/mol. Its IUPAC name is 4-[4-[21,21-bis(2-ethoxyethyl)-10,18-dimethoxy-5-(4-methoxyphenyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenyl]morpholine.
| Compound Name | 4-[4-[21,21-bis(2-ethoxyethyl)-10,18-dimethoxy-5-(4-methoxyphenyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenyl]morpholine |
|---|---|
| PubChem CID | 170010609 |
| Molecular Formula | C47H51NO7 |
| Molecular Weight | 741.92 g/mol |
| Exact Mass | 741.37 |
| IUPAC Name | 4-[4-[21,21-bis(2-ethoxyethyl)-10,18-dimethoxy-5-(4-methoxyphenyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenyl]morpholine |
| SMILES | CCOCCC1(CCOCC)c2cc(OC)ccc2-c2c1c1c(c3cc(OC)ccc23)OC(c2ccc(OC)cc2)(c2ccc(N3CCOCC3)cc2)C=C1 |
| InChI | InChI=1S/C47H51NO7/c1-6-52-26-22-46(23-27-53-7-2)42-31-37(51-5)17-19-39(42)43-38-18-16-36(50-4)30-41(38)45-40(44(43)46)20-21-47(55-45,33-10-14-35(49-3)15-11-33)32-8-12-34(13-9-32)48-24-28-54-29-25-48/h8-21,30-31H,6-7,22-29H2,1-5H3 |
| InChIKey | CETRMMMKTUURLI-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 67.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.92 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|