C49H46N2O4 — CID 168851819
4-[4-[5-(4-methoxyphenyl)-21,21-dimethyl-10-morpholin-4-yl-18-phenyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenyl]morpholine (PubChem CID 168851819) has the molecular formula C49H46N2O4 and a molecular weight of 726.92 g/mol. Its IUPAC name is 4-[4-[5-(4-methoxyphenyl)-21,21-dimethyl-10-morpholin-4-yl-18-phenyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenyl]morpholine.
| Compound Name | 4-[4-[5-(4-methoxyphenyl)-21,21-dimethyl-10-morpholin-4-yl-18-phenyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenyl]morpholine |
|---|---|
| PubChem CID | 168851819 |
| Molecular Formula | C49H46N2O4 |
| Molecular Weight | 726.92 g/mol |
| Exact Mass | 726.35 |
| IUPAC Name | 4-[4-[5-(4-methoxyphenyl)-21,21-dimethyl-10-morpholin-4-yl-18-phenyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-5-yl]phenyl]morpholine |
| SMILES | COc1ccc(C2(c3ccc(N4CCOCC4)cc3)C=Cc3c4c(c5ccc(N6CCOCC6)cc5c3O2)-c2ccc(-c3ccccc3)cc2C4(C)C)cc1 |
| InChI | InChI=1S/C49H46N2O4/c1-48(2)44-31-34(33-7-5-4-6-8-33)9-19-41(44)45-40-20-16-38(51-25-29-54-30-26-51)32-43(40)47-42(46(45)48)21-22-49(55-47,36-12-17-39(52-3)18-13-36)35-10-14-37(15-11-35)50-23-27-53-28-24-50/h4-22,31-32H,23-30H2,1-3H3 |
| InChIKey | JAXBUPVHVKOBKX-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.92 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|