C41H36N2O4 — CID 169307240
10,11-dimethoxy-21,21-dimethyl-5-(4-morpholin-4-ylphenyl)-5-phenyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaene-18-carbonitrile (PubChem CID 169307240) has the molecular formula C41H36N2O4 and a molecular weight of 620.75 g/mol. Its IUPAC name is 10,11-dimethoxy-21,21-dimethyl-5-(4-morpholin-4-ylphenyl)-5-phenyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaene-18-carbonitrile.
| Compound Name | 10,11-dimethoxy-21,21-dimethyl-5-(4-morpholin-4-ylphenyl)-5-phenyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaene-18-carbonitrile |
|---|---|
| PubChem CID | 169307240 |
| Molecular Formula | C41H36N2O4 |
| Molecular Weight | 620.75 g/mol |
| Exact Mass | 620.27 |
| IUPAC Name | 10,11-dimethoxy-21,21-dimethyl-5-(4-morpholin-4-ylphenyl)-5-phenyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaene-18-carbonitrile |
| SMILES | COc1cc2c3c(c4c(c2cc1OC)-c1ccc(C#N)cc1C4(C)C)C=CC(c1ccccc1)(c1ccc(N2CCOCC2)cc1)O3 |
| InChI | InChI=1S/C41H36N2O4/c1-40(2)34-22-26(25-42)10-15-30(34)37-32-23-35(44-3)36(45-4)24-33(32)39-31(38(37)40)16-17-41(47-39,27-8-6-5-7-9-27)28-11-13-29(14-12-28)43-18-20-46-21-19-43/h5-17,22-24H,18-21H2,1-4H3 |
| InChIKey | IPBMVBQNSITUDC-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 63.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.75 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|