C40H37NO4 — CID 12994773
4-[4-(4,18-dimethoxy-21,21-dimethyl-10-phenyl-9-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,5,8(13),11,15(20),16,18-nonaen-10-yl)phenyl]morpholine (PubChem CID 12994773) has the molecular formula C40H37NO4 and a molecular weight of 595.74 g/mol. Its IUPAC name is 4-[4-(4,18-dimethoxy-21,21-dimethyl-10-phenyl-9-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,5,8(13),11,15(20),16,18-nonaen-10-yl)phenyl]morpholine.
| Compound Name | 4-[4-(4,18-dimethoxy-21,21-dimethyl-10-phenyl-9-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,5,8(13),11,15(20),16,18-nonaen-10-yl)phenyl]morpholine |
|---|---|
| PubChem CID | 12994773 |
| Molecular Formula | C40H37NO4 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.27 |
| IUPAC Name | 4-[4-(4,18-dimethoxy-21,21-dimethyl-10-phenyl-9-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,5,8(13),11,15(20),16,18-nonaen-10-yl)phenyl]morpholine |
| SMILES | COc1ccc2c(c1)C(C)(C)c1c-2c2c(c3ccc(OC)cc13)OC(c1ccccc1)(c1ccc(N3CCOCC3)cc1)C=C2 |
| InChI | InChI=1S/C40H37NO4/c1-39(2)35-25-30(43-4)15-17-32(35)36-33-18-19-40(26-8-6-5-7-9-26,27-10-12-28(13-11-27)41-20-22-44-23-21-41)45-38(33)31-16-14-29(42-3)24-34(31)37(36)39/h5-19,24-25H,20-23H2,1-4H3 |
| InChIKey | HRUZYVOPQXPNNB-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|