C43H43NO5 — CID 168851743
4-[4-[21,21-diethyl-10,11-dimethoxy-5-(4-methoxyphenyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15,17,19-nonaen-5-yl]phenyl]morpholine (PubChem CID 168851743) has the molecular formula C43H43NO5 and a molecular weight of 653.82 g/mol. Its IUPAC name is 4-[4-[21,21-diethyl-10,11-dimethoxy-5-(4-methoxyphenyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15,17,19-nonaen-5-yl]phenyl]morpholine.
| Compound Name | 4-[4-[21,21-diethyl-10,11-dimethoxy-5-(4-methoxyphenyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15,17,19-nonaen-5-yl]phenyl]morpholine |
|---|---|
| PubChem CID | 168851743 |
| Molecular Formula | C43H43NO5 |
| Molecular Weight | 653.82 g/mol |
| Exact Mass | 653.31 |
| IUPAC Name | 4-[4-[21,21-diethyl-10,11-dimethoxy-5-(4-methoxyphenyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15,17,19-nonaen-5-yl]phenyl]morpholine |
| SMILES | CCC1(CC)c2ccccc2-c2c1c1c(c3cc(OC)c(OC)cc23)OC(c2ccc(OC)cc2)(c2ccc(N3CCOCC3)cc2)C=C1 |
| InChI | InChI=1S/C43H43NO5/c1-6-42(7-2)36-11-9-8-10-32(36)39-34-26-37(46-4)38(47-5)27-35(34)41-33(40(39)42)20-21-43(49-41,29-14-18-31(45-3)19-15-29)28-12-16-30(17-13-28)44-22-24-48-25-23-44/h8-21,26-27H,6-7,22-25H2,1-5H3 |
| InChIKey | LJBDQXWMMLPWSF-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.82 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|