C45H36F3NO2 — CID 66935313
4-[4-[21,21-dimethyl-5-phenyl-18-[2-(trifluoromethyl)phenyl]-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaen-5-yl]phenyl]morpholine (PubChem CID 66935313) has the molecular formula C45H36F3NO2 and a molecular weight of 679.78 g/mol. Its IUPAC name is 4-[4-[21,21-dimethyl-5-phenyl-18-[2-(trifluoromethyl)phenyl]-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaen-5-yl]phenyl]morpholine.
| Compound Name | 4-[4-[21,21-dimethyl-5-phenyl-18-[2-(trifluoromethyl)phenyl]-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaen-5-yl]phenyl]morpholine |
|---|---|
| PubChem CID | 66935313 |
| Molecular Formula | C45H36F3NO2 |
| Molecular Weight | 679.78 g/mol |
| Exact Mass | 679.27 |
| IUPAC Name | 4-[4-[21,21-dimethyl-5-phenyl-18-[2-(trifluoromethyl)phenyl]-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaen-5-yl]phenyl]morpholine |
| SMILES | CC1(C)c2cc(-c3ccccc3C(F)(F)F)ccc2-c2c1c1c(c3ccccc23)OC(c2ccccc2)(c2ccc(N3CCOCC3)cc2)C=C1 |
| InChI | InChI=1S/C45H36F3NO2/c1-43(2)39-28-29(33-12-8-9-15-38(33)45(46,47)48)16-21-36(39)40-34-13-6-7-14-35(34)42-37(41(40)43)22-23-44(51-42,30-10-4-3-5-11-30)31-17-19-32(20-18-31)49-24-26-50-27-25-49/h3-23,28H,24-27H2,1-2H3 |
| InChIKey | UYWIIKPOTVYEFS-UHFFFAOYSA-N |
| XLogP | 11.02 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.78 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|