C45H43N3O — CID 168851850
1-[4-[18-isocyano-21,21-dimethyl-5-(4-piperidin-1-ylphenyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaen-5-yl]phenyl]piperidine (PubChem CID 168851850) has the molecular formula C45H43N3O and a molecular weight of 641.86 g/mol. Its IUPAC name is 1-[4-[18-isocyano-21,21-dimethyl-5-(4-piperidin-1-ylphenyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaen-5-yl]phenyl]piperidine.
| Compound Name | 1-[4-[18-isocyano-21,21-dimethyl-5-(4-piperidin-1-ylphenyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaen-5-yl]phenyl]piperidine |
|---|---|
| PubChem CID | 168851850 |
| Molecular Formula | C45H43N3O |
| Molecular Weight | 641.86 g/mol |
| Exact Mass | 641.34 |
| IUPAC Name | 1-[4-[18-isocyano-21,21-dimethyl-5-(4-piperidin-1-ylphenyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaen-5-yl]phenyl]piperidine |
| SMILES | [C-]#[N+]c1ccc2c(c1)C(C)(C)c1c3c(c4ccccc4c1-2)OC(c1ccc(N2CCCCC2)cc1)(c1ccc(N2CCCCC2)cc1)C=C3 |
| InChI | InChI=1S/C45H43N3O/c1-44(2)40-30-33(46-3)18-23-38(40)41-36-12-6-7-13-37(36)43-39(42(41)44)24-25-45(49-43,31-14-19-34(20-15-31)47-26-8-4-9-27-47)32-16-21-35(22-17-32)48-28-10-5-11-29-48/h6-7,12-25,30H,4-5,8-11,26-29H2,1-2H3 |
| InChIKey | NUXBGABWGXCSRQ-UHFFFAOYSA-N |
| XLogP | 11.03 |
| TPSA | 20.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.86 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|