C37H30N2O — CID 168851514
4-(18-isocyano-21,21-dimethyl-5-phenyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaen-5-yl)-N,N-dimethylaniline (PubChem CID 168851514) has the molecular formula C37H30N2O and a molecular weight of 518.66 g/mol. Its IUPAC name is 4-(18-isocyano-21,21-dimethyl-5-phenyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaen-5-yl)-N,N-dimethylaniline.
| Compound Name | 4-(18-isocyano-21,21-dimethyl-5-phenyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaen-5-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 168851514 |
| Molecular Formula | C37H30N2O |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | 4-(18-isocyano-21,21-dimethyl-5-phenyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaen-5-yl)-N,N-dimethylaniline |
| SMILES | [C-]#[N+]c1ccc2c(c1)C(C)(C)c1c3c(c4ccccc4c1-2)OC(c1ccccc1)(c1ccc(N(C)C)cc1)C=C3 |
| InChI | InChI=1S/C37H30N2O/c1-36(2)32-23-26(38-3)17-20-30(32)33-28-13-9-10-14-29(28)35-31(34(33)36)21-22-37(40-35,24-11-7-6-8-12-24)25-15-18-27(19-16-25)39(4)5/h6-23H,1-2,4-5H3 |
| InChIKey | IVCPNASLTMPMIG-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 16.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|