C49H37NO3 — CID 171403234
21,21-diethyl-18-isocyano-5,5-bis(4-phenoxyphenyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaene (PubChem CID 171403234) has the molecular formula C49H37NO3 and a molecular weight of 687.84 g/mol. Its IUPAC name is 21,21-diethyl-18-isocyano-5,5-bis(4-phenoxyphenyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaene.
| Compound Name | 21,21-diethyl-18-isocyano-5,5-bis(4-phenoxyphenyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaene |
|---|---|
| PubChem CID | 171403234 |
| Molecular Formula | C49H37NO3 |
| Molecular Weight | 687.84 g/mol |
| Exact Mass | 687.28 |
| IUPAC Name | 21,21-diethyl-18-isocyano-5,5-bis(4-phenoxyphenyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaene |
| SMILES | [C-]#[N+]c1ccc2c(c1)C(CC)(CC)c1c3c(c4ccccc4c1-2)OC(c1ccc(Oc2ccccc2)cc1)(c1ccc(Oc2ccccc2)cc1)C=C3 |
| InChI | InChI=1S/C49H37NO3/c1-4-48(5-2)44-32-35(50-3)24-29-42(44)45-40-18-12-13-19-41(40)47-43(46(45)48)30-31-49(53-47,33-20-25-38(26-21-33)51-36-14-8-6-9-15-36)34-22-27-39(28-23-34)52-37-16-10-7-11-17-37/h6-32H,4-5H2,1-2H3 |
| InChIKey | IDIAWDKVYJSXGA-UHFFFAOYSA-N |
| XLogP | 13.41 |
| TPSA | 32.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.84 |
| LogP ≤ 5 | 13.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|