C44H43NO2 — CID 171403187
21,21-diethyl-5-(4-hexylphenyl)-18-isocyano-5-(4-methoxyphenyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaene (PubChem CID 171403187) has the molecular formula C44H43NO2 and a molecular weight of 617.83 g/mol. Its IUPAC name is 21,21-diethyl-5-(4-hexylphenyl)-18-isocyano-5-(4-methoxyphenyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaene.
| Compound Name | 21,21-diethyl-5-(4-hexylphenyl)-18-isocyano-5-(4-methoxyphenyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaene |
|---|---|
| PubChem CID | 171403187 |
| Molecular Formula | C44H43NO2 |
| Molecular Weight | 617.83 g/mol |
| Exact Mass | 617.33 |
| IUPAC Name | 21,21-diethyl-5-(4-hexylphenyl)-18-isocyano-5-(4-methoxyphenyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaene |
| SMILES | [C-]#[N+]c1ccc2c(c1)C(CC)(CC)c1c3c(c4ccccc4c1-2)OC(c1ccc(CCCCCC)cc1)(c1ccc(OC)cc1)C=C3 |
| InChI | InChI=1S/C44H43NO2/c1-6-9-10-11-14-30-17-19-31(20-18-30)44(32-21-24-34(46-5)25-22-32)28-27-38-41-40(35-15-12-13-16-36(35)42(38)47-44)37-26-23-33(45-4)29-39(37)43(41,7-2)8-3/h12-13,15-29H,6-11,14H2,1-3,5H3 |
| InChIKey | WTFFUDBCSPMXGV-UHFFFAOYSA-N |
| XLogP | 11.96 |
| TPSA | 22.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.83 |
| LogP ≤ 5 | 11.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|