C41H37NO5 — CID 168851638
21,21-diethyl-18-isocyano-10,11-dimethoxy-5,5-bis(4-methoxyphenyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaene (PubChem CID 168851638) has the molecular formula C41H37NO5 and a molecular weight of 623.75 g/mol. Its IUPAC name is 21,21-diethyl-18-isocyano-10,11-dimethoxy-5,5-bis(4-methoxyphenyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaene.
| Compound Name | 21,21-diethyl-18-isocyano-10,11-dimethoxy-5,5-bis(4-methoxyphenyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaene |
|---|---|
| PubChem CID | 168851638 |
| Molecular Formula | C41H37NO5 |
| Molecular Weight | 623.75 g/mol |
| Exact Mass | 623.27 |
| IUPAC Name | 21,21-diethyl-18-isocyano-10,11-dimethoxy-5,5-bis(4-methoxyphenyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaene |
| SMILES | [C-]#[N+]c1ccc2c(c1)C(CC)(CC)c1c3c(c4cc(OC)c(OC)cc4c1-2)OC(c1ccc(OC)cc1)(c1ccc(OC)cc1)C=C3 |
| InChI | InChI=1S/C41H37NO5/c1-8-40(9-2)34-22-27(42-3)14-19-30(34)37-32-23-35(45-6)36(46-7)24-33(32)39-31(38(37)40)20-21-41(47-39,25-10-15-28(43-4)16-11-25)26-12-17-29(44-5)18-13-26/h10-24H,8-9H2,1-2,4-7H3 |
| InChIKey | ZFTVZUJMMYBKQY-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 50.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.75 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|