C42H29NO3 — CID 168851801
5-dibenzofuran-2-yl-18-isocyano-5-(4-methoxyphenyl)-21,21-dimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaene (PubChem CID 168851801) has the molecular formula C42H29NO3 and a molecular weight of 595.70 g/mol. Its IUPAC name is 5-dibenzofuran-2-yl-18-isocyano-5-(4-methoxyphenyl)-21,21-dimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaene.
| Compound Name | 5-dibenzofuran-2-yl-18-isocyano-5-(4-methoxyphenyl)-21,21-dimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaene |
|---|---|
| PubChem CID | 168851801 |
| Molecular Formula | C42H29NO3 |
| Molecular Weight | 595.70 g/mol |
| Exact Mass | 595.21 |
| IUPAC Name | 5-dibenzofuran-2-yl-18-isocyano-5-(4-methoxyphenyl)-21,21-dimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaene |
| SMILES | [C-]#[N+]c1ccc2c(c1)C(C)(C)c1c3c(c4ccccc4c1-2)OC(c1ccc(OC)cc1)(c1ccc2oc4ccccc4c2c1)C=C3 |
| InChI | InChI=1S/C42H29NO3/c1-41(2)35-24-27(43-3)16-19-32(35)38-30-10-5-6-11-31(30)40-33(39(38)41)21-22-42(46-40,25-13-17-28(44-4)18-14-25)26-15-20-37-34(23-26)29-9-7-8-12-36(29)45-37/h5-24H,1-2,4H3 |
| InChIKey | HPYOHPNAFOTLAN-UHFFFAOYSA-N |
| XLogP | 10.95 |
| TPSA | 35.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.70 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|