C44H36N2O — CID 168851768
1-[4-(18-isocyano-21,21-dimethyl-5-naphthalen-2-yl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaen-5-yl)phenyl]piperidine (PubChem CID 168851768) has the molecular formula C44H36N2O and a molecular weight of 608.79 g/mol. Its IUPAC name is 1-[4-(18-isocyano-21,21-dimethyl-5-naphthalen-2-yl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaen-5-yl)phenyl]piperidine.
| Compound Name | 1-[4-(18-isocyano-21,21-dimethyl-5-naphthalen-2-yl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaen-5-yl)phenyl]piperidine |
|---|---|
| PubChem CID | 168851768 |
| Molecular Formula | C44H36N2O |
| Molecular Weight | 608.79 g/mol |
| Exact Mass | 608.28 |
| IUPAC Name | 1-[4-(18-isocyano-21,21-dimethyl-5-naphthalen-2-yl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15(20),16,18-nonaen-5-yl)phenyl]piperidine |
| SMILES | [C-]#[N+]c1ccc2c(c1)C(C)(C)c1c3c(c4ccccc4c1-2)OC(c1ccc(N2CCCCC2)cc1)(c1ccc2ccccc2c1)C=C3 |
| InChI | InChI=1S/C44H36N2O/c1-43(2)39-28-33(45-3)19-22-37(39)40-35-13-7-8-14-36(35)42-38(41(40)43)23-24-44(47-42,32-16-15-29-11-5-6-12-30(29)27-32)31-17-20-34(21-18-31)46-25-9-4-10-26-46/h5-8,11-24,27-28H,4,9-10,25-26H2,1-2H3 |
| InChIKey | DHXVUEGTSFMSCO-UHFFFAOYSA-N |
| XLogP | 11.19 |
| TPSA | 16.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.79 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|