C60H61NO4 — CID 159728450
N-[5,5-bis(4-butoxyphenyl)-18-phenyl-21,21-dipropyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-11-yl]-4-methylbenzamide (PubChem CID 159728450) has the molecular formula C60H61NO4 and a molecular weight of 860.15 g/mol. Its IUPAC name is N-[5,5-bis(4-butoxyphenyl)-18-phenyl-21,21-dipropyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-11-yl]-4-methylbenzamide.
| Compound Name | N-[5,5-bis(4-butoxyphenyl)-18-phenyl-21,21-dipropyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-11-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 159728450 |
| Molecular Formula | C60H61NO4 |
| Molecular Weight | 860.15 g/mol |
| Exact Mass | 859.46 |
| IUPAC Name | N-[5,5-bis(4-butoxyphenyl)-18-phenyl-21,21-dipropyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-11-yl]-4-methylbenzamide |
| SMILES | CCCCOc1ccc(C2(c3ccc(OCCCC)cc3)C=Cc3c4c(c5cc(NC(=O)c6ccc(C)cc6)ccc5c3O2)-c2ccc(-c3ccccc3)cc2C4(CCC)CCC)cc1 |
| InChI | InChI=1S/C60H61NO4/c1-6-10-37-63-48-27-22-45(23-28-48)60(46-24-29-49(30-25-46)64-38-11-7-2)36-33-52-56-55(51-31-21-44(42-15-13-12-14-16-42)39-54(51)59(56,34-8-3)35-9-4)53-40-47(26-32-50(53)57(52)65-60)61-58(62)43-19-17-41(5)18-20-43/h12-33,36,39-40H,6-11,34-35,37-38H2,1-5H3,(H,61,62) |
| InChIKey | NAXSZQMUTPJALQ-UHFFFAOYSA-N |
| XLogP | 15.64 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.15 |
| LogP ≤ 5 | 15.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|