C47H43NO4 — CID 158610740
N-[5-(4-butoxyphenyl)-5-(4-methoxyphenyl)-18,21,21-trimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-11-yl]benzamide (PubChem CID 158610740) has the molecular formula C47H43NO4 and a molecular weight of 685.86 g/mol. Its IUPAC name is N-[5-(4-butoxyphenyl)-5-(4-methoxyphenyl)-18,21,21-trimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-11-yl]benzamide.
| Compound Name | N-[5-(4-butoxyphenyl)-5-(4-methoxyphenyl)-18,21,21-trimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-11-yl]benzamide |
|---|---|
| PubChem CID | 158610740 |
| Molecular Formula | C47H43NO4 |
| Molecular Weight | 685.86 g/mol |
| Exact Mass | 685.32 |
| IUPAC Name | N-[5-(4-butoxyphenyl)-5-(4-methoxyphenyl)-18,21,21-trimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaen-11-yl]benzamide |
| SMILES | CCCCOc1ccc(C2(c3ccc(OC)cc3)C=Cc3c4c(c5cc(NC(=O)c6ccccc6)ccc5c3O2)-c2ccc(C)cc2C4(C)C)cc1 |
| InChI | InChI=1S/C47H43NO4/c1-6-7-27-51-36-21-16-33(17-22-36)47(32-14-19-35(50-5)20-15-32)26-25-39-43-42(38-23-13-30(2)28-41(38)46(43,3)4)40-29-34(18-24-37(40)44(39)52-47)48-45(49)31-11-9-8-10-12-31/h8-26,28-29H,6-7,27H2,1-5H3,(H,48,49) |
| InChIKey | HWUOLTSUZRSWKO-UHFFFAOYSA-N |
| XLogP | 11.24 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.86 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|