C40H34BrF3O3 — CID 142468694
11-bromo-5-(4-butoxyphenyl)-5-(4-methoxyphenyl)-21,21-dimethyl-18-(trifluoromethyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaene (PubChem CID 142468694) has the molecular formula C40H34BrF3O3 and a molecular weight of 699.61 g/mol. Its IUPAC name is 11-bromo-5-(4-butoxyphenyl)-5-(4-methoxyphenyl)-21,21-dimethyl-18-(trifluoromethyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaene.
| Compound Name | 11-bromo-5-(4-butoxyphenyl)-5-(4-methoxyphenyl)-21,21-dimethyl-18-(trifluoromethyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaene |
|---|---|
| PubChem CID | 142468694 |
| Molecular Formula | C40H34BrF3O3 |
| Molecular Weight | 699.61 g/mol |
| Exact Mass | 698.16 |
| IUPAC Name | 11-bromo-5-(4-butoxyphenyl)-5-(4-methoxyphenyl)-21,21-dimethyl-18-(trifluoromethyl)-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8(13),9,11,15(20),16,18-nonaene |
| SMILES | CCCCOc1ccc(C2(c3ccc(OC)cc3)C=Cc3c4c(c5cc(Br)ccc5c3O2)-c2ccc(C(F)(F)F)cc2C4(C)C)cc1 |
| InChI | InChI=1S/C40H34BrF3O3/c1-5-6-21-46-29-15-9-25(10-16-29)39(24-7-13-28(45-4)14-8-24)20-19-32-36-35(33-23-27(41)12-18-30(33)37(32)47-39)31-17-11-26(40(42,43)44)22-34(31)38(36,2)3/h7-20,22-23H,5-6,21H2,1-4H3 |
| InChIKey | PYGQCHXYFJECPK-UHFFFAOYSA-N |
| XLogP | 11.46 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.61 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|