C53H51NO6 — CID 90407215
dimethyl 8-[4-[[4-(4-pentylcyclohexyl)benzoyl]amino]phenyl]-2,2-diphenylbenzo[h]chromene-5,6-dicarboxylate (PubChem CID 90407215) has the molecular formula C53H51NO6 and a molecular weight of 797.99 g/mol. Its IUPAC name is dimethyl 8-[4-[[4-(4-pentylcyclohexyl)benzoyl]amino]phenyl]-2,2-diphenylbenzo[h]chromene-5,6-dicarboxylate.
| Compound Name | dimethyl 8-[4-[[4-(4-pentylcyclohexyl)benzoyl]amino]phenyl]-2,2-diphenylbenzo[h]chromene-5,6-dicarboxylate |
|---|---|
| PubChem CID | 90407215 |
| Molecular Formula | C53H51NO6 |
| Molecular Weight | 797.99 g/mol |
| Exact Mass | 797.37 |
| IUPAC Name | dimethyl 8-[4-[[4-(4-pentylcyclohexyl)benzoyl]amino]phenyl]-2,2-diphenylbenzo[h]chromene-5,6-dicarboxylate |
| SMILES | CCCCCC1CCC(c2ccc(C(=O)Nc3ccc(-c4ccc5c6c(c(C(=O)OC)c(C(=O)OC)c5c4)C=CC(c4ccccc4)(c4ccccc4)O6)cc3)cc2)CC1 |
| InChI | InChI=1S/C53H51NO6/c1-4-5-8-13-35-18-20-36(21-19-35)37-22-24-39(25-23-37)50(55)54-43-29-26-38(27-30-43)40-28-31-44-46(34-40)48(52(57)59-3)47(51(56)58-2)45-32-33-53(60-49(44)45,41-14-9-6-10-15-41)42-16-11-7-12-17-42/h6-7,9-12,14-17,22-36H,4-5,8,13,18-21H2,1-3H3,(H,54,55) |
| InChIKey | YAJCFOKGPGGCCY-UHFFFAOYSA-N |
| XLogP | 12.54 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.99 |
| LogP ≤ 5 | 12.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|