C64H69NO7 — CID 90414935
5-O-methyl 8-O-[4-[4-[4-(4-pentylcyclohexyl)benzoyl]oxyphenyl]cyclohexyl] 6-methyl-2-phenyl-2-(4-piperidin-1-ylphenyl)benzo[h]chromene-5,8-dicarboxylate (PubChem CID 90414935) has the molecular formula C64H69NO7 and a molecular weight of 964.26 g/mol. Its IUPAC name is 5-O-methyl 8-O-[4-[4-[4-(4-pentylcyclohexyl)benzoyl]oxyphenyl]cyclohexyl] 6-methyl-2-phenyl-2-(4-piperidin-1-ylphenyl)benzo[h]chromene-5,8-dicarboxylate.
| Compound Name | 5-O-methyl 8-O-[4-[4-[4-(4-pentylcyclohexyl)benzoyl]oxyphenyl]cyclohexyl] 6-methyl-2-phenyl-2-(4-piperidin-1-ylphenyl)benzo[h]chromene-5,8-dicarboxylate |
|---|---|
| PubChem CID | 90414935 |
| Molecular Formula | C64H69NO7 |
| Molecular Weight | 964.26 g/mol |
| Exact Mass | 963.51 |
| IUPAC Name | 5-O-methyl 8-O-[4-[4-[4-(4-pentylcyclohexyl)benzoyl]oxyphenyl]cyclohexyl] 6-methyl-2-phenyl-2-(4-piperidin-1-ylphenyl)benzo[h]chromene-5,8-dicarboxylate |
| SMILES | CCCCCC1CCC(c2ccc(C(=O)Oc3ccc(C4CCC(OC(=O)c5ccc6c7c(c(C(=O)OC)c(C)c6c5)C=CC(c5ccccc5)(c5ccc(N6CCCCC6)cc5)O7)CC4)cc3)cc2)CC1 |
| InChI | InChI=1S/C64H69NO7/c1-4-5-8-13-44-16-18-45(19-17-44)46-20-22-49(23-21-46)61(66)70-54-33-24-47(25-34-54)48-26-35-55(36-27-48)71-62(67)50-28-37-56-58(42-50)43(2)59(63(68)69-3)57-38-39-64(72-60(56)57,51-14-9-6-10-15-51)52-29-31-53(32-30-52)65-40-11-7-12-41-65/h6,9-10,14-15,20-25,28-34,37-39,42,44-45,48,55H,4-5,7-8,11-13,16-19,26-27,35-36,40-41H2,1-3H3 |
| InChIKey | HYCQULCMYWLFJV-UHFFFAOYSA-N |
| XLogP | 15.23 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 964.26 |
| LogP ≤ 5 | 15.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|