C61H62N2O5 — CID 90418120
methyl 2-(4-methoxyphenyl)-6-methyl-8-[4-[4-[4-(4-pentylcyclohexyl)phenyl]benzoyl]piperazin-1-yl]-2-phenylnaphtho[2,1-h]chromene-5-carboxylate (PubChem CID 90418120) has the molecular formula C61H62N2O5 and a molecular weight of 903.18 g/mol. Its IUPAC name is methyl 2-(4-methoxyphenyl)-6-methyl-8-[4-[4-[4-(4-pentylcyclohexyl)phenyl]benzoyl]piperazin-1-yl]-2-phenylnaphtho[2,1-h]chromene-5-carboxylate.
| Compound Name | methyl 2-(4-methoxyphenyl)-6-methyl-8-[4-[4-[4-(4-pentylcyclohexyl)phenyl]benzoyl]piperazin-1-yl]-2-phenylnaphtho[2,1-h]chromene-5-carboxylate |
|---|---|
| PubChem CID | 90418120 |
| Molecular Formula | C61H62N2O5 |
| Molecular Weight | 903.18 g/mol |
| Exact Mass | 902.47 |
| IUPAC Name | methyl 2-(4-methoxyphenyl)-6-methyl-8-[4-[4-[4-(4-pentylcyclohexyl)phenyl]benzoyl]piperazin-1-yl]-2-phenylnaphtho[2,1-h]chromene-5-carboxylate |
| SMILES | CCCCCC1CCC(c2ccc(-c3ccc(C(=O)N4CCN(c5cc6c(C)c(C(=O)OC)c7c(c6c6ccccc56)OC(c5ccccc5)(c5ccc(OC)cc5)C=C7)CC4)cc3)cc2)CC1 |
| InChI | InChI=1S/C61H62N2O5/c1-5-6-8-13-42-18-20-43(21-19-42)44-22-24-45(25-23-44)46-26-28-47(29-27-46)59(64)63-38-36-62(37-39-63)55-40-54-41(2)56(60(65)67-4)53-34-35-61(48-14-9-7-10-15-48,49-30-32-50(66-3)33-31-49)68-58(53)57(54)52-17-12-11-16-51(52)55/h7,9-12,14-17,22-35,40,42-43H,5-6,8,13,18-21,36-39H2,1-4H3 |
| InChIKey | DPVNLKHBGVBZDR-UHFFFAOYSA-N |
| XLogP | 13.93 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.18 |
| LogP ≤ 5 | 13.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|