C30H35NO — CID 138461387
4-(4-butylcyclohexyl)-N-[4-(4-methylphenyl)phenyl]benzamide (PubChem CID 138461387) has the molecular formula C30H35NO and a molecular weight of 425.62 g/mol. Its IUPAC name is 4-(4-butylcyclohexyl)-N-[4-(4-methylphenyl)phenyl]benzamide.
| Compound Name | 4-(4-butylcyclohexyl)-N-[4-(4-methylphenyl)phenyl]benzamide |
|---|---|
| PubChem CID | 138461387 |
| Molecular Formula | C30H35NO |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | 4-(4-butylcyclohexyl)-N-[4-(4-methylphenyl)phenyl]benzamide |
| SMILES | CCCCC1CCC(c2ccc(C(=O)Nc3ccc(-c4ccc(C)cc4)cc3)cc2)CC1 |
| InChI | InChI=1S/C30H35NO/c1-3-4-5-23-8-12-25(13-9-23)26-14-16-28(17-15-26)30(32)31-29-20-18-27(19-21-29)24-10-6-22(2)7-11-24/h6-7,10-11,14-21,23,25H,3-5,8-9,12-13H2,1-2H3,(H,31,32) |
| InChIKey | BOHDNZUQSLGYFI-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |