C31H37NO — CID 67989976
N-(4-methylphenyl)-4-[4-(4-pentan-2-ylcyclohexyl)phenyl]benzamide (PubChem CID 67989976) has the molecular formula C31H37NO and a molecular weight of 439.64 g/mol. Its IUPAC name is N-(4-methylphenyl)-4-[4-(4-pentan-2-ylcyclohexyl)phenyl]benzamide.
| Compound Name | N-(4-methylphenyl)-4-[4-(4-pentan-2-ylcyclohexyl)phenyl]benzamide |
|---|---|
| PubChem CID | 67989976 |
| Molecular Formula | C31H37NO |
| Molecular Weight | 439.64 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | N-(4-methylphenyl)-4-[4-(4-pentan-2-ylcyclohexyl)phenyl]benzamide |
| SMILES | CCCC(C)C1CCC(c2ccc(-c3ccc(C(=O)Nc4ccc(C)cc4)cc3)cc2)CC1 |
| InChI | InChI=1S/C31H37NO/c1-4-5-23(3)24-8-10-25(11-9-24)26-12-14-27(15-13-26)28-16-18-29(19-17-28)31(33)32-30-20-6-22(2)7-21-30/h6-7,12-21,23-25H,4-5,8-11H2,1-3H3,(H,32,33) |
| InChIKey | YMMFBXSSMSNHFY-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.64 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |