C21H25NO — CID 90397286
N-[4-[4-(4-methylcyclohexyl)phenyl]phenyl]acetamide (PubChem CID 90397286) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is N-[4-[4-(4-methylcyclohexyl)phenyl]phenyl]acetamide.
| Compound Name | N-[4-[4-(4-methylcyclohexyl)phenyl]phenyl]acetamide |
|---|---|
| PubChem CID | 90397286 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | N-[4-[4-(4-methylcyclohexyl)phenyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2ccc(C3CCC(C)CC3)cc2)cc1 |
| InChI | InChI=1S/C21H25NO/c1-15-3-5-17(6-4-15)18-7-9-19(10-8-18)20-11-13-21(14-12-20)22-16(2)23/h7-15,17H,3-6H2,1-2H3,(H,22,23) |
| InChIKey | CTZXDMXDFUDYAW-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |